C36H38N8O3 — CID 170326031
N-[5-[(6-amino-6-iminohexyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide (PubChem CID 170326031) has the molecular formula C36H38N8O3 and a molecular weight of 630.75 g/mol. Its IUPAC name is N-[5-[(6-amino-6-iminohexyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide.
| Compound Name | N-[5-[(6-amino-6-iminohexyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170326031 |
| Molecular Formula | C36H38N8O3 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | N-[5-[(6-amino-6-iminohexyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)CCCCCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3ccc(/C=C/c4cnc5ccccc5c4)cc3)cn2C)cn1C |
| InChI | InChI=1S/C36H38N8O3/c1-43-23-29(19-31(43)35(46)39-17-7-3-4-10-33(37)38)42-36(47)32-20-28(22-44(32)2)41-34(45)26-15-13-24(14-16-26)11-12-25-18-27-8-5-6-9-30(27)40-21-25/h5-6,8-9,11-16,18-23H,3-4,7,10,17H2,1-2H3,(H3,37,38)(H,39,46)(H,41,45)(H,42,47)/b12-11+ |
| InChIKey | CJFUAGVPZWXMJF-VAWYXSNFSA-N |
| XLogP | 5.81 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|