C34H43N9O3 — CID 170575781
N-(5-amino-5-iminopentyl)-1-methyl-4-(methylamino)pyrrole-2-carboxamide;6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)pyridine-3-carboxamide (PubChem CID 170575781) has the molecular formula C34H43N9O3 and a molecular weight of 625.78 g/mol. Its IUPAC name is N-(5-amino-5-iminopentyl)-1-methyl-4-(methylamino)pyrrole-2-carboxamide;6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)pyridine-3-carboxamide.
| Compound Name | N-(5-amino-5-iminopentyl)-1-methyl-4-(methylamino)pyrrole-2-carboxamide;6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170575781 |
| Molecular Formula | C34H43N9O3 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.35 |
| IUPAC Name | N-(5-amino-5-iminopentyl)-1-methyl-4-(methylamino)pyrrole-2-carboxamide;6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)pyridine-3-carboxamide |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(C(=O)Nc3cc(C=O)n(C)c3)cn2)cc1.[H]/N=C(\N)CCCCNC(=O)c1cc(NC)cn1C |
| InChI | InChI=1S/C22H22N4O2.C12H21N5O/c1-25(2)20-10-5-16(6-11-20)4-8-18-9-7-17(13-23-18)22(28)24-19-12-21(15-27)26(3)14-19;1-15-9-7-10(17(2)8-9)12(18)16-6-4-3-5-11(13)14/h4-15H,1-3H3,(H,24,28);7-8,15H,3-6H2,1-2H3,(H3,13,14)(H,16,18)/b8-4+; |
| InChIKey | SUZNFYXLCLHKGE-ZFXMFRGYSA-N |
| XLogP | 4.62 |
| TPSA | 163.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|