C30H31N9O4 — CID 170575804
N-(3-amino-3-iminopropyl)-4-(methylamino)-1H-pyrrole-2-carboxamide;4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)benzamide (PubChem CID 170575804) has the molecular formula C30H31N9O4 and a molecular weight of 581.64 g/mol. Its IUPAC name is N-(3-amino-3-iminopropyl)-4-(methylamino)-1H-pyrrole-2-carboxamide;4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)benzamide.
| Compound Name | N-(3-amino-3-iminopropyl)-4-(methylamino)-1H-pyrrole-2-carboxamide;4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)benzamide |
|---|---|
| PubChem CID | 170575804 |
| Molecular Formula | C30H31N9O4 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | N-(3-amino-3-iminopropyl)-4-(methylamino)-1H-pyrrole-2-carboxamide;4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]-N-(5-formyl-1-methylpyrrol-3-yl)benzamide |
| SMILES | Cn1cc(NC(=O)c2ccc(/C=C/c3ccc4nonc4c3)cc2)cc1C=O.[H]/N=C(\N)CCNC(=O)c1cc(NC)c[nH]1 |
| InChI | InChI=1S/C21H16N4O3.C9H15N5O/c1-25-12-17(11-18(25)13-26)22-21(27)16-7-4-14(5-8-16)2-3-15-6-9-19-20(10-15)24-28-23-19;1-12-6-4-7(14-5-6)9(15)13-3-2-8(10)11/h2-13H,1H3,(H,22,27);4-5,12,14H,2-3H2,1H3,(H3,10,11)(H,13,15)/b3-2+; |
| InChIKey | UDMIFINQQOGPFT-SQQVDAMQSA-N |
| XLogP | 3.91 |
| TPSA | 196.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|