C32H33N9O4 — CID 177291104
3-(3-amino-3-ethyliminopropyl)-4-[[4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 177291104) has the molecular formula C32H33N9O4 and a molecular weight of 607.68 g/mol. Its IUPAC name is 3-(3-amino-3-ethyliminopropyl)-4-[[4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | 3-(3-amino-3-ethyliminopropyl)-4-[[4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 177291104 |
| Molecular Formula | C32H33N9O4 |
| Molecular Weight | 607.68 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 3-(3-amino-3-ethyliminopropyl)-4-[[4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | CC/N=C(\N)CCc1c(NC(=O)c2cc(NC(=O)c3ccc(/C=C/c4ccc5nonc5c4)cc3)cn2C)cn(C)c1C(N)=O |
| InChI | InChI=1S/C32H33N9O4/c1-4-35-28(33)14-12-23-26(18-41(3)29(23)30(34)42)37-32(44)27-16-22(17-40(27)2)36-31(43)21-10-7-19(8-11-21)5-6-20-9-13-24-25(15-20)39-45-38-24/h5-11,13,15-18H,4,12,14H2,1-3H3,(H2,33,35)(H2,34,42)(H,36,43)(H,37,44)/b6-5+ |
| InChIKey | AYEDDRNAIXQDTL-AATRIKPKSA-N |
| XLogP | 3.98 |
| TPSA | 188.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|