C41H48N8O3 — CID 170326163
N-[5-[[3-(butylamino)-3-butyliminopropyl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide (PubChem CID 170326163) has the molecular formula C41H48N8O3 and a molecular weight of 700.89 g/mol. Its IUPAC name is N-[5-[[3-(butylamino)-3-butyliminopropyl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide.
| Compound Name | N-[5-[[3-(butylamino)-3-butyliminopropyl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170326163 |
| Molecular Formula | C41H48N8O3 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | N-[5-[[3-(butylamino)-3-butyliminopropyl]carbamoyl]-1-methylpyrrol-3-yl]-1-methyl-4-[[4-[(E)-2-quinolin-3-ylethenyl]benzoyl]amino]pyrrole-2-carboxamide |
| SMILES | CCCC/N=C(/CCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3ccc(/C=C/c4cnc5ccccc5c4)cc3)cn2C)cn1C)NCCCC |
| InChI | InChI=1S/C41H48N8O3/c1-5-7-20-42-38(43-21-8-6-2)19-22-44-40(51)36-24-34(28-48(36)3)47-41(52)37-25-33(27-49(37)4)46-39(50)31-17-15-29(16-18-31)13-14-30-23-32-11-9-10-12-35(32)45-26-30/h9-18,23-28H,5-8,19-22H2,1-4H3,(H,42,43)(H,44,51)(H,46,50)(H,47,52)/b14-13+ |
| InChIKey | JJUFLMGHXRAUQS-BUHFOSPRSA-N |
| XLogP | 7.30 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|