C34H35N9O4S — CID 170326036
4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-N-[5-[(3-imino-3-thiomorpholin-4-ylpropyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 170326036) has the molecular formula C34H35N9O4S and a molecular weight of 665.78 g/mol. Its IUPAC name is 4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-N-[5-[(3-imino-3-thiomorpholin-4-ylpropyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-N-[5-[(3-imino-3-thiomorpholin-4-ylpropyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 170326036 |
| Molecular Formula | C34H35N9O4S |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 4-[[4-[(E)-2-(2,1,3-benzoxadiazol-5-yl)ethenyl]benzoyl]amino]-N-[5-[(3-imino-3-thiomorpholin-4-ylpropyl)carbamoyl]-1-methylpyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | [H]/N=C(/CCNC(=O)c1cc(NC(=O)c2cc(NC(=O)c3ccc(/C=C/c4ccc5nonc5c4)cc3)cn2C)cn1C)N1CCSCC1 |
| InChI | InChI=1S/C34H35N9O4S/c1-41-21-26(18-29(41)33(45)36-12-11-31(35)43-13-15-48-16-14-43)38-34(46)30-19-25(20-42(30)2)37-32(44)24-8-5-22(6-9-24)3-4-23-7-10-27-28(17-23)40-47-39-27/h3-10,17-21,35H,11-16H2,1-2H3,(H,36,45)(H,37,44)(H,38,46)/b4-3+,35-31- |
| InChIKey | HTTKHEPJLILXDL-OSAZQAOSSA-N |
| XLogP | 4.72 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|