C11H12N2O4 — CID 155547061
methyl 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylate (PubChem CID 155547061) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is methyl 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylate.
| Compound Name | methyl 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylate |
|---|---|
| PubChem CID | 155547061 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | methyl 2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)=[N+]([O-])C(C)(C)[N+]=2[O-] |
| InChI | InChI=1S/C11H12N2O4/c1-11(2)12(15)8-5-4-7(10(14)17-3)6-9(8)13(11)16/h4-6H,1-3H3 |
| InChIKey | PFROAEHVTYCPCG-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|