C30H28Cl3N3O5 — CID 155547556
3-[2-(tert-butylamino)-1-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylic acid (PubChem CID 155547556) has the molecular formula C30H28Cl3N3O5 and a molecular weight of 616.93 g/mol. Its IUPAC name is 3-[2-(tert-butylamino)-1-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[2-(tert-butylamino)-1-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 155547556 |
| Molecular Formula | C30H28Cl3N3O5 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | 3-[2-(tert-butylamino)-1-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylic acid |
| SMILES | CC(C)(C)NC(=O)C(c1c(C(=O)O)[nH]c2cc(Cl)ccc12)N(C=O)Cc1ccc(OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C30H28Cl3N3O5/c1-30(2,3)35-28(38)27(25-21-10-7-19(31)13-24(21)34-26(25)29(39)40)36(16-37)14-17-4-8-20(9-5-17)41-15-18-6-11-22(32)23(33)12-18/h4-13,16,27,34H,14-15H2,1-3H3,(H,35,38)(H,39,40) |
| InChIKey | HIWJCCRUFKOHBM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|