C33H36ClN3O6 — CID 155560734
ethyl 3-[2-(tert-butylamino)-1-[formyl-[[4-[(3-methoxyphenyl)methoxy]phenyl]methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate (PubChem CID 155560734) has the molecular formula C33H36ClN3O6 and a molecular weight of 606.12 g/mol. Its IUPAC name is ethyl 3-[2-(tert-butylamino)-1-[formyl-[[4-[(3-methoxyphenyl)methoxy]phenyl]methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[2-(tert-butylamino)-1-[formyl-[[4-[(3-methoxyphenyl)methoxy]phenyl]methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 155560734 |
| Molecular Formula | C33H36ClN3O6 |
| Molecular Weight | 606.12 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | ethyl 3-[2-(tert-butylamino)-1-[formyl-[[4-[(3-methoxyphenyl)methoxy]phenyl]methyl]amino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C(C(=O)NC(C)(C)C)N(C=O)Cc1ccc(OCc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C33H36ClN3O6/c1-6-42-32(40)29-28(26-15-12-23(34)17-27(26)35-29)30(31(39)36-33(2,3)4)37(20-38)18-21-10-13-24(14-11-21)43-19-22-8-7-9-25(16-22)41-5/h7-17,20,30,35H,6,18-19H2,1-5H3,(H,36,39) |
| InChIKey | RINDFYCHEUNXAY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.12 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|