C25H28ClN3O4 — CID 87112888
2-[benzyl(formyl)amino]-N-tert-butyl-2-[6-chloro-2-(4-methyl-1,3-dioxetan-2-yl)-1H-indol-3-yl]acetamide (PubChem CID 87112888) has the molecular formula C25H28ClN3O4 and a molecular weight of 469.97 g/mol. Its IUPAC name is 2-[benzyl(formyl)amino]-N-tert-butyl-2-[6-chloro-2-(4-methyl-1,3-dioxetan-2-yl)-1H-indol-3-yl]acetamide.
| Compound Name | 2-[benzyl(formyl)amino]-N-tert-butyl-2-[6-chloro-2-(4-methyl-1,3-dioxetan-2-yl)-1H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 87112888 |
| Molecular Formula | C25H28ClN3O4 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[benzyl(formyl)amino]-N-tert-butyl-2-[6-chloro-2-(4-methyl-1,3-dioxetan-2-yl)-1H-indol-3-yl]acetamide |
| SMILES | CC1OC(c2[nH]c3cc(Cl)ccc3c2C(C(=O)NC(C)(C)C)N(C=O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C25H28ClN3O4/c1-15-32-24(33-15)21-20(18-11-10-17(26)12-19(18)27-21)22(23(31)28-25(2,3)4)29(14-30)13-16-8-6-5-7-9-16/h5-12,14-15,22,24,27H,13H2,1-4H3,(H,28,31) |
| InChIKey | HESNWUVSAIGQFJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|