C25H28ClN3O4 — CID 141328617
3-[1-(benzylamino)-3-(cyclohexylamino)-3-hydroxy-1-oxopropan-2-yl]-6-chloro-1H-indole-2-carboxylic acid (PubChem CID 141328617) has the molecular formula C25H28ClN3O4 and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-[1-(benzylamino)-3-(cyclohexylamino)-3-hydroxy-1-oxopropan-2-yl]-6-chloro-1H-indole-2-carboxylic acid.
| Compound Name | 3-[1-(benzylamino)-3-(cyclohexylamino)-3-hydroxy-1-oxopropan-2-yl]-6-chloro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141328617 |
| Molecular Formula | C25H28ClN3O4 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 3-[1-(benzylamino)-3-(cyclohexylamino)-3-hydroxy-1-oxopropan-2-yl]-6-chloro-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2cc(Cl)ccc2c1C(C(=O)NCc1ccccc1)C(O)NC1CCCCC1 |
| InChI | InChI=1S/C25H28ClN3O4/c26-16-11-12-18-19(13-16)29-22(25(32)33)20(18)21(24(31)28-17-9-5-2-6-10-17)23(30)27-14-15-7-3-1-4-8-15/h1,3-4,7-8,11-13,17,21,24,28-29,31H,2,5-6,9-10,14H2,(H,27,30)(H,32,33) |
| InChIKey | OUTICXLEFFUYHC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|