C29H28ClN3O4 — CID 56942694
ethyl 3-[1-[acetyl(benzyl)amino]-2-(benzylamino)-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate (PubChem CID 56942694) has the molecular formula C29H28ClN3O4 and a molecular weight of 518.01 g/mol. Its IUPAC name is ethyl 3-[1-[acetyl(benzyl)amino]-2-(benzylamino)-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[1-[acetyl(benzyl)amino]-2-(benzylamino)-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 56942694 |
| Molecular Formula | C29H28ClN3O4 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | ethyl 3-[1-[acetyl(benzyl)amino]-2-(benzylamino)-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C(C(=O)NCc1ccccc1)N(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C29H28ClN3O4/c1-3-37-29(36)26-25(23-15-14-22(30)16-24(23)32-26)27(28(35)31-17-20-10-6-4-7-11-20)33(19(2)34)18-21-12-8-5-9-13-21/h4-16,27,32H,3,17-18H2,1-2H3,(H,31,35) |
| InChIKey | NLVIZLGASWNCTQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|