C20H22F3N3O4 — CID 155549210
(3R,5R)-5-[2-[(2E)-2-[[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]piperidine-3-carboxylic acid (PubChem CID 155549210) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is (3R,5R)-5-[2-[(2E)-2-[[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5R)-5-[2-[(2E)-2-[[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155549210 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (3R,5R)-5-[2-[(2E)-2-[[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]hydrazinyl]ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](CCN/N=C/c2ccc(-c3ccccc3OC(F)(F)F)o2)C1 |
| InChI | InChI=1S/C20H22F3N3O4/c21-20(22,23)30-18-4-2-1-3-16(18)17-6-5-15(29-17)12-26-25-8-7-13-9-14(19(27)28)11-24-10-13/h1-6,12-14,24-25H,7-11H2,(H,27,28)/b26-12+/t13-,14+/m0/s1 |
| InChIKey | XAXVMKWGZGMNMU-VNWGXMQCSA-N |
| XLogP | 3.47 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|