C22H19N5O2S — CID 155550032
1-[4-(11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]-3-phenylurea (PubChem CID 155550032) has the molecular formula C22H19N5O2S and a molecular weight of 417.49 g/mol. Its IUPAC name is 1-[4-(11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 155550032 |
| Molecular Formula | C22H19N5O2S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[4-(11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-ylamino)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(Nc2ncnc3sc4c(c23)CCOC4)cc1 |
| InChI | InChI=1S/C22H19N5O2S/c28-22(26-14-4-2-1-3-5-14)27-16-8-6-15(7-9-16)25-20-19-17-10-11-29-12-18(17)30-21(19)24-13-23-20/h1-9,13H,10-12H2,(H,23,24,25)(H2,26,27,28) |
| InChIKey | YCSHAGXLTWKJNF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |