C24H21N2O3P — CID 155550611
benzyl (2S,3S)-2-cyano-3-diphenylphosphoryl-2-methylaziridine-1-carboxylate (PubChem CID 155550611) has the molecular formula C24H21N2O3P and a molecular weight of 416.42 g/mol. Its IUPAC name is benzyl (2S,3S)-2-cyano-3-diphenylphosphoryl-2-methylaziridine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-2-cyano-3-diphenylphosphoryl-2-methylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 155550611 |
| Molecular Formula | C24H21N2O3P |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | benzyl (2S,3S)-2-cyano-3-diphenylphosphoryl-2-methylaziridine-1-carboxylate |
| SMILES | C[C@]1(C#N)[C@H](P(=O)(c2ccccc2)c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H21N2O3P/c1-24(18-25)22(26(24)23(27)29-17-19-11-5-2-6-12-19)30(28,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22H,17H2,1H3/t22-,24-,26?/m0/s1 |
| InChIKey | TZKHJDMAMGXKNU-RLANRKKRSA-N |
| XLogP | 4.26 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|