C19H24N6OS — CID 155553896
3-[[6-[[4-(1-amino-3-phenylpropyl)-1,3-thiazol-2-yl]amino]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 155553896) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[[6-[[4-(1-amino-3-phenylpropyl)-1,3-thiazol-2-yl]amino]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[6-[[4-(1-amino-3-phenylpropyl)-1,3-thiazol-2-yl]amino]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 155553896 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-[[6-[[4-(1-amino-3-phenylpropyl)-1,3-thiazol-2-yl]amino]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | NC(CCc1ccccc1)c1csc(Nc2cc(NCCCO)ncn2)n1 |
| InChI | InChI=1S/C19H24N6OS/c20-15(8-7-14-5-2-1-3-6-14)16-12-27-19(24-16)25-18-11-17(22-13-23-18)21-9-4-10-26/h1-3,5-6,11-13,15,26H,4,7-10,20H2,(H2,21,22,23,24,25) |
| InChIKey | LZPWYQABGPMMFC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|