C26H24ClN5O2S — CID 155555123
(1R,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-[2-(3-methylphenyl)ethylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155555123) has the molecular formula C26H24ClN5O2S and a molecular weight of 506.03 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-[2-(3-methylphenyl)ethylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-[2-(3-methylphenyl)ethylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155555123 |
| Molecular Formula | C26H24ClN5O2S |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-[2-(3-methylphenyl)ethylamino]purin-9-yl]bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Cc1cccc(CCNc2nc(C#Cc3ccc(Cl)s3)nc3c2ncn3[C@H]2[C@H](O)[C@H](O)[C@@H]3C[C@@H]32)c1 |
| InChI | InChI=1S/C26H24ClN5O2S/c1-14-3-2-4-15(11-14)9-10-28-25-21-26(31-20(30-25)8-6-16-5-7-19(27)35-16)32(13-29-21)22-17-12-18(17)23(33)24(22)34/h2-5,7,11,13,17-18,22-24,33-34H,9-10,12H2,1H3,(H,28,30,31)/t17-,18+,22+,23+,24-/m0/s1 |
| InChIKey | SBFAOBRHMFHNPX-RSVOXEIVSA-N |
| XLogP | 3.82 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|