C36H37Br2N3O — CID 155555157
(6aR,11bR)-10-bromo-4-methoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide (PubChem CID 155555157) has the molecular formula C36H37Br2N3O and a molecular weight of 687.52 g/mol. Its IUPAC name is (6aR,11bR)-10-bromo-4-methoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide.
| Compound Name | (6aR,11bR)-10-bromo-4-methoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
|---|---|
| PubChem CID | 155555157 |
| Molecular Formula | C36H37Br2N3O |
| Molecular Weight | 687.52 g/mol |
| Exact Mass | 685.13 |
| IUPAC Name | (6aR,11bR)-10-bromo-4-methoxy-5-[3-[2-methyl-3-[(4-methylphenyl)methyl]benzimidazol-3-ium-1-yl]propyl]-6,6a,7,11b-tetrahydroindeno[2,1-c]quinoline bromide |
| SMILES | COc1cccc2c1N(CCCn1c(C)[n+](Cc3ccc(C)cc3)c3ccccc31)C[C@@H]1Cc3ccc(Br)cc3[C@H]21.[Br-] |
| InChI | InChI=1S/C36H37BrN3O.BrH/c1-24-12-14-26(15-13-24)22-40-25(2)39(32-9-4-5-10-33(32)40)19-7-18-38-23-28-20-27-16-17-29(37)21-31(27)35(28)30-8-6-11-34(41-3)36(30)38;/h4-6,8-17,21,28,35H,7,18-20,22-23H2,1-3H3;1H/q+1;/p-1/t28-,35-;/m0./s1 |
| InChIKey | RNIXTMYLQRDOQG-YEEMJREWSA-M |
| XLogP | 4.58 |
| TPSA | 21.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|