C24H29N7O3 — CID 155555739
1-[4-[4-amino-7-(2-ethoxyethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea (PubChem CID 155555739) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 1-[4-[4-amino-7-(2-ethoxyethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[4-[4-amino-7-(2-ethoxyethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 155555739 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 1-[4-[4-amino-7-(2-ethoxyethyl)pyrrolo[2,3-d]pyrimidin-5-yl]phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
| SMILES | CCOCCn1cc(-c2ccc(NC(=O)Nc3cc(C(C)(C)C)on3)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C24H29N7O3/c1-5-33-11-10-31-13-17(20-21(25)26-14-27-22(20)31)15-6-8-16(9-7-15)28-23(32)29-19-12-18(34-30-19)24(2,3)4/h6-9,12-14H,5,10-11H2,1-4H3,(H2,25,26,27)(H2,28,29,30,32) |
| InChIKey | DPKIZOKNKFLJEC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|