C23H28N2O3 — CID 155556068
(1R,2R,17S,25S)-10-methoxy-13-oxa-15,21-diazahexacyclo[15.7.1.02,15.05,14.07,12.021,25]pentacosa-5(14),7(12),8,10-tetraen-6-one (PubChem CID 155556068) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (1R,2R,17S,25S)-10-methoxy-13-oxa-15,21-diazahexacyclo[15.7.1.02,15.05,14.07,12.021,25]pentacosa-5(14),7(12),8,10-tetraen-6-one.
| Compound Name | (1R,2R,17S,25S)-10-methoxy-13-oxa-15,21-diazahexacyclo[15.7.1.02,15.05,14.07,12.021,25]pentacosa-5(14),7(12),8,10-tetraen-6-one |
|---|---|
| PubChem CID | 155556068 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (1R,2R,17S,25S)-10-methoxy-13-oxa-15,21-diazahexacyclo[15.7.1.02,15.05,14.07,12.021,25]pentacosa-5(14),7(12),8,10-tetraen-6-one |
| SMILES | COc1ccc2c(=O)c3c(oc2c1)N1C[C@@H]2CCCN4CCC[C@@H]([C@H]24)[C@H]1CC3 |
| InChI | InChI=1S/C23H28N2O3/c1-27-15-6-7-17-20(12-15)28-23-18(22(17)26)8-9-19-16-5-3-11-24-10-2-4-14(21(16)24)13-25(19)23/h6-7,12,14,16,19,21H,2-5,8-11,13H2,1H3/t14-,16+,19+,21-/m0/s1 |
| InChIKey | OBPAMGODNGEKDE-SSOMFZRPSA-N |
| XLogP | 3.43 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |