C21H22N4O4 — CID 155556783
methyl 4-[[3-(butylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]carbamoyl]benzoate (PubChem CID 155556783) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is methyl 4-[[3-(butylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-(butylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 155556783 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | methyl 4-[[3-(butylcarbamoyl)imidazo[1,2-a]pyridin-2-yl]carbamoyl]benzoate |
| SMILES | CCCCNC(=O)c1c(NC(=O)c2ccc(C(=O)OC)cc2)nc2ccccn12 |
| InChI | InChI=1S/C21H22N4O4/c1-3-4-12-22-20(27)17-18(23-16-7-5-6-13-25(16)17)24-19(26)14-8-10-15(11-9-14)21(28)29-2/h5-11,13H,3-4,12H2,1-2H3,(H,22,27)(H,24,26) |
| InChIKey | SFIKVOKMSKILMD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|