C21H19F4N3S — CID 155557112
4-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]thiomorpholine (PubChem CID 155557112) has the molecular formula C21H19F4N3S and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]thiomorpholine.
| Compound Name | 4-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]thiomorpholine |
|---|---|
| PubChem CID | 155557112 |
| Molecular Formula | C21H19F4N3S |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 4-[[1-(4-fluorophenyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]methyl]thiomorpholine |
| SMILES | Fc1ccc(-n2nc(CN3CCSCC3)cc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H19F4N3S/c22-17-5-7-19(8-6-17)28-20(15-1-3-16(4-2-15)21(23,24)25)13-18(26-28)14-27-9-11-29-12-10-27/h1-8,13H,9-12,14H2 |
| InChIKey | XSNCMGIVZCAUTP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |