C25H32FN3Si — CID 155557396
1-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane (PubChem CID 155557396) has the molecular formula C25H32FN3Si and a molecular weight of 421.64 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane.
| Compound Name | 1-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
|---|---|
| PubChem CID | 155557396 |
| Molecular Formula | C25H32FN3Si |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)-5-(4-propan-2-ylphenyl)pyrazol-3-yl]methyl]-4,4-dimethyl-1,4-azasilinane |
| SMILES | CC(C)c1ccc(-c2cc(CN3CC[Si](C)(C)CC3)nn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H32FN3Si/c1-19(2)20-5-7-21(8-6-20)25-17-23(18-28-13-15-30(3,4)16-14-28)27-29(25)24-11-9-22(26)10-12-24/h5-12,17,19H,13-16,18H2,1-4H3 |
| InChIKey | WJRRLFSXZLAKDB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|