C19H16F3N3O2S — CID 155558073
N-[3-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]methanesulfonamide (PubChem CID 155558073) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is N-[3-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 155558073 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-[3-[6-amino-5-[3-(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2cnc(N)c(-c3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C19H16F3N3O2S/c1-28(26,27)25-16-7-3-4-12(9-16)14-10-17(18(23)24-11-14)13-5-2-6-15(8-13)19(20,21)22/h2-11,25H,1H3,(H2,23,24) |
| InChIKey | ABORJTJIHVIIRM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |