C22H24N4O2 — CID 155558286
[4-[(3-phenoxyphenyl)methyl]-1,4-diazepan-1-yl]-pyrazol-1-ylmethanone (PubChem CID 155558286) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is [4-[(3-phenoxyphenyl)methyl]-1,4-diazepan-1-yl]-pyrazol-1-ylmethanone.
| Compound Name | [4-[(3-phenoxyphenyl)methyl]-1,4-diazepan-1-yl]-pyrazol-1-ylmethanone |
|---|---|
| PubChem CID | 155558286 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [4-[(3-phenoxyphenyl)methyl]-1,4-diazepan-1-yl]-pyrazol-1-ylmethanone |
| SMILES | O=C(N1CCCN(Cc2cccc(Oc3ccccc3)c2)CC1)n1cccn1 |
| InChI | InChI=1S/C22H24N4O2/c27-22(26-14-5-11-23-26)25-13-6-12-24(15-16-25)18-19-7-4-10-21(17-19)28-20-8-2-1-3-9-20/h1-5,7-11,14,17H,6,12-13,15-16,18H2 |
| InChIKey | ILPNGPFSXOQIFP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |