C9H9N5 — CID 155559132
4-amino-2-[methyl(prop-2-ynyl)amino]pyrimidine-5-carbonitrile (PubChem CID 155559132) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is 4-amino-2-[methyl(prop-2-ynyl)amino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[methyl(prop-2-ynyl)amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155559132 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 4-amino-2-[methyl(prop-2-ynyl)amino]pyrimidine-5-carbonitrile |
| SMILES | C#CCN(C)c1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C9H9N5/c1-3-4-14(2)9-12-6-7(5-10)8(11)13-9/h1,6H,4H2,2H3,(H2,11,12,13) |
| InChIKey | ZOPHGHXJLPUSNW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|