C20H32O3 — CID 155559823
(2R,4S,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,4,5-triol (PubChem CID 155559823) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2R,4S,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,4,5-triol.
| Compound Name | (2R,4S,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,4,5-triol |
|---|---|
| PubChem CID | 155559823 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2R,4S,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,4,5-triol |
| SMILES | C=C[C@]1(C)C=C2CC[C@H]3C(C)(C)[C@H](O)C[C@H](O)[C@]3(C)[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C20H32O3/c1-6-19(4)10-12-7-8-14-18(2,3)15(22)9-16(23)20(14,5)17(12)13(21)11-19/h6,10,13-17,21-23H,1,7-9,11H2,2-5H3/t13-,14+,15-,16+,17-,19-,20-/m1/s1 |
| InChIKey | XUUISTPPZJETLP-SKSNXLECSA-N |
| XLogP | 3.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|