About 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole
1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole (PubChem CID 155561094) has the molecular formula C21H17Cl2N3O
and a molecular weight of 398.29 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole.
Molecular Properties
| Compound Name | 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole |
| PubChem CID | 155561094 |
| Molecular Formula | C21H17Cl2N3O |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole |
| SMILES | COc1ccc(-c2c[nH]cc2C(c2ccc(Cl)cc2Cl)n2ccnc2)cc1 |
| InChI | InChI=1S/C21H17Cl2N3O/c1-27-16-5-2-14(3-6-16)18-11-25-12-19(18)21(26-9-8-24-13-26)17-7-4-15(22)10-20(17)23/h2-13,21,25H,1H3 |
| InChIKey | QIWLCGOYUQUQHI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole?
The IUPAC name of 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole (CID 155561094) is 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole.
What is the SMILES notation for 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole?
The canonical SMILES for 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole is COc1ccc(-c2c[nH]cc2C(c2ccc(Cl)cc2Cl)n2ccnc2)cc1.
What is the InChIKey of 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole?
The InChIKey is QIWLCGOYUQUQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17Cl2N3O/c1-27-16-5-2-14(3-6-16)18-11-25-12-19(18)21(26-9-8-24-13-26)17-7-4-15(22)10-20(17)23/h2-13,21,25H,1H3.
What are the key properties of 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole?
1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole has a molecular weight of 398.29 g/mol, XLogP of 5.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dichlorophenyl)-[4-(4-methoxyphenyl)-1H-pyrrol-3-yl]methyl]imidazole is sourced from PubChem (CID 155561094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).