About (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol
(2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol (PubChem CID 10572263) has the molecular formula C17H11Cl4NO
and a molecular weight of 387.09 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol |
| PubChem CID | 10572263 |
| Molecular Formula | C17H11Cl4NO |
| Molecular Weight | 387.09 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol |
| SMILES | OC(c1ccc(Cl)cc1Cl)c1c[nH]cc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H11Cl4NO/c18-10-2-3-11(15(20)6-10)17(23)13-8-22-7-12(13)9-1-4-14(19)16(21)5-9/h1-8,17,22-23H |
| InChIKey | OJFVEBGIMFVJSM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.09 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol?
The IUPAC name of (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol (CID 10572263) is (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol.
What is the SMILES notation for (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol?
The canonical SMILES for (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol is OC(c1ccc(Cl)cc1Cl)c1c[nH]cc1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol?
The InChIKey is OJFVEBGIMFVJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl4NO/c18-10-2-3-11(15(20)6-10)17(23)13-8-22-7-12(13)9-1-4-14(19)16(21)5-9/h1-8,17,22-23H.
What are the key properties of (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol?
(2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol has a molecular weight of 387.09 g/mol, XLogP of 6.38, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)-[4-(3,4-dichlorophenyl)-1H-pyrrol-3-yl]methanol is sourced from PubChem (CID 10572263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).