C26H26N2O3 — CID 155561294
4-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-N-(2-pyridin-4-ylethyl)benzamide (PubChem CID 155561294) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-N-(2-pyridin-4-ylethyl)benzamide.
| Compound Name | 4-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-N-(2-pyridin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 155561294 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-N-(2-pyridin-4-ylethyl)benzamide |
| SMILES | C=Cc1c(OC)cc(/C=C/c2ccc(C(=O)NCCc3ccncc3)cc2)cc1OC |
| InChI | InChI=1S/C26H26N2O3/c1-4-23-24(30-2)17-21(18-25(23)31-3)6-5-19-7-9-22(10-8-19)26(29)28-16-13-20-11-14-27-15-12-20/h4-12,14-15,17-18H,1,13,16H2,2-3H3,(H,28,29)/b6-5+ |
| InChIKey | FEFLECRETSSNDN-AATRIKPKSA-N |
| XLogP | 4.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|