C19H20N4O4 — CID 155561330
N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxybutanamide (PubChem CID 155561330) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxybutanamide.
| Compound Name | N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxybutanamide |
|---|---|
| PubChem CID | 155561330 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-hydroxy-4-[6-(6-methoxy-3-pyridinyl)-4-methylquinazolin-8-yl]oxybutanamide |
| SMILES | COc1ccc(-c2cc(OCCCC(=O)NO)c3ncnc(C)c3c2)cn1 |
| InChI | InChI=1S/C19H20N4O4/c1-12-15-8-14(13-5-6-18(26-2)20-10-13)9-16(19(15)22-11-21-12)27-7-3-4-17(24)23-25/h5-6,8-11,25H,3-4,7H2,1-2H3,(H,23,24) |
| InChIKey | LROLEVRTIPTNKW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|