C27H28F2N6O2S — CID 155562691
3-(2-amino-1,3-thiazol-4-yl)-1-ethyl-6-fluoro-7-[4-[(2E)-2-(4-fluorophenyl)-2-methoxyiminoethyl]piperazin-1-yl]quinolin-4-one (PubChem CID 155562691) has the molecular formula C27H28F2N6O2S and a molecular weight of 538.62 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)-1-ethyl-6-fluoro-7-[4-[(2E)-2-(4-fluorophenyl)-2-methoxyiminoethyl]piperazin-1-yl]quinolin-4-one.
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)-1-ethyl-6-fluoro-7-[4-[(2E)-2-(4-fluorophenyl)-2-methoxyiminoethyl]piperazin-1-yl]quinolin-4-one |
|---|---|
| PubChem CID | 155562691 |
| Molecular Formula | C27H28F2N6O2S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)-1-ethyl-6-fluoro-7-[4-[(2E)-2-(4-fluorophenyl)-2-methoxyiminoethyl]piperazin-1-yl]quinolin-4-one |
| SMILES | CCn1cc(-c2csc(N)n2)c(=O)c2cc(F)c(N3CCN(C/C(=N/OC)c4ccc(F)cc4)CC3)cc21 |
| InChI | InChI=1S/C27H28F2N6O2S/c1-3-34-14-20(23-16-38-27(30)31-23)26(36)19-12-21(29)25(13-24(19)34)35-10-8-33(9-11-35)15-22(32-37-2)17-4-6-18(28)7-5-17/h4-7,12-14,16H,3,8-11,15H2,1-2H3,(H2,30,31)/b32-22- |
| InChIKey | ZJNVJJKLVCVRSL-JDCMOKTRSA-N |
| XLogP | 4.18 |
| TPSA | 88.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|