C26H31N7O — CID 155567447
(E)-N-[4-[[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide (PubChem CID 155567447) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is (E)-N-[4-[[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide.
| Compound Name | (E)-N-[4-[[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 155567447 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (E)-N-[4-[[[6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(CNc2cc(Nc3ccc(N4CCN(C)CC4)cc3)ncn2)cc1 |
| InChI | InChI=1S/C26H31N7O/c1-3-4-26(34)31-22-7-5-20(6-8-22)18-27-24-17-25(29-19-28-24)30-21-9-11-23(12-10-21)33-15-13-32(2)14-16-33/h3-12,17,19H,13-16,18H2,1-2H3,(H,31,34)(H2,27,28,29,30)/b4-3+ |
| InChIKey | PQUKVMAVTZDURV-ONEGZZNKSA-N |
| XLogP | 4.10 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|