C19H21N7O — CID 155556321
(E)-N-[3-[[[6-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide (PubChem CID 155556321) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is (E)-N-[3-[[[6-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide.
| Compound Name | (E)-N-[3-[[[6-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 155556321 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (E)-N-[3-[[[6-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]amino]methyl]phenyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1cccc(CNc2cc(Nc3cnn(C)c3)ncn2)c1 |
| InChI | InChI=1S/C19H21N7O/c1-3-5-19(27)25-15-7-4-6-14(8-15)10-20-17-9-18(22-13-21-17)24-16-11-23-26(2)12-16/h3-9,11-13H,10H2,1-2H3,(H,25,27)(H2,20,21,22,24)/b5-3+ |
| InChIKey | GXAMADMEMDRBID-HWKANZROSA-N |
| XLogP | 3.08 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|