C27H31N3 — CID 155570005
N-(4-propan-2-ylphenyl)-2-[6-[2-(4-propan-2-ylphenyl)iminoethyl]-2-pyridinyl]ethanimine (PubChem CID 155570005) has the molecular formula C27H31N3 and a molecular weight of 397.57 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-2-[6-[2-(4-propan-2-ylphenyl)iminoethyl]-2-pyridinyl]ethanimine.
| Compound Name | N-(4-propan-2-ylphenyl)-2-[6-[2-(4-propan-2-ylphenyl)iminoethyl]-2-pyridinyl]ethanimine |
|---|---|
| PubChem CID | 155570005 |
| Molecular Formula | C27H31N3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-2-[6-[2-(4-propan-2-ylphenyl)iminoethyl]-2-pyridinyl]ethanimine |
| SMILES | CC(C)c1ccc(/N=C/Cc2cccc(C/C=N/c3ccc(C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H31N3/c1-20(2)22-8-12-24(13-9-22)28-18-16-26-6-5-7-27(30-26)17-19-29-25-14-10-23(11-15-25)21(3)4/h5-15,18-21H,16-17H2,1-4H3/b28-18+,29-19+ |
| InChIKey | CPIQMXRFXUUAGA-UOSOPFLXSA-N |
| XLogP | 7.22 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|