C20H24N6S — CID 155571464
N-[1-[4-[amino-[(Z)-1-amino-1-cyclopropylprop-1-en-2-yl]amino]phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 155571464) has the molecular formula C20H24N6S and a molecular weight of 380.52 g/mol. Its IUPAC name is N-[1-[4-[amino-[(Z)-1-amino-1-cyclopropylprop-1-en-2-yl]amino]phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[4-[amino-[(Z)-1-amino-1-cyclopropylprop-1-en-2-yl]amino]phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155571464 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[1-[4-[amino-[(Z)-1-amino-1-cyclopropylprop-1-en-2-yl]amino]phenyl]ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | C/C(=C(/N)C1CC1)N(N)c1ccc(C(C)Nc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C20H24N6S/c1-12(25-19-17-9-10-27-20(17)24-11-23-19)14-5-7-16(8-6-14)26(22)13(2)18(21)15-3-4-15/h5-12,15H,3-4,21-22H2,1-2H3,(H,23,24,25)/b18-13- |
| InChIKey | LBRZPLZSOOMSCQ-AQTBWJFISA-N |
| XLogP | 4.14 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|