C22H20F2N2O2 — CID 155571812
N-[bis(4-methylphenyl)methyl]-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 155571812) has the molecular formula C22H20F2N2O2 and a molecular weight of 382.41 g/mol. Its IUPAC name is N-[bis(4-methylphenyl)methyl]-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[bis(4-methylphenyl)methyl]-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155571812 |
| Molecular Formula | C22H20F2N2O2 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[bis(4-methylphenyl)methyl]-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)c2ccc(C(F)F)[nH]c2=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H20F2N2O2/c1-13-3-7-15(8-4-13)19(16-9-5-14(2)6-10-16)26-22(28)17-11-12-18(20(23)24)25-21(17)27/h3-12,19-20H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | YISUNKBVUPGYCO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |