C23H24N2O3 — CID 51591493
N-[(S)-(2-methoxyphenyl)-phenylmethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide (PubChem CID 51591493) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(S)-(2-methoxyphenyl)-phenylmethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide.
| Compound Name | N-[(S)-(2-methoxyphenyl)-phenylmethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51591493 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(S)-(2-methoxyphenyl)-phenylmethyl]-2-oxo-6-propan-2-yl-1H-pyridine-3-carboxamide |
| SMILES | COc1ccccc1[C@@H](NC(=O)c1ccc(C(C)C)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O3/c1-15(2)19-14-13-18(22(26)24-19)23(27)25-21(16-9-5-4-6-10-16)17-11-7-8-12-20(17)28-3/h4-15,21H,1-3H3,(H,24,26)(H,25,27)/t21-/m0/s1 |
| InChIKey | MMYXCIIZOMWZLF-NRFANRHFSA-N |
| XLogP | 4.03 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |