C23H25ClN2O4 — CID 110181282
[6-(benzhydrylcarbamoyl)-2,3,4-trimethoxyphenyl]azanium chloride (PubChem CID 110181282) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is [6-(benzhydrylcarbamoyl)-2,3,4-trimethoxyphenyl]azanium chloride.
| Compound Name | [6-(benzhydrylcarbamoyl)-2,3,4-trimethoxyphenyl]azanium chloride |
|---|---|
| PubChem CID | 110181282 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [6-(benzhydrylcarbamoyl)-2,3,4-trimethoxyphenyl]azanium chloride |
| SMILES | COc1cc(C(=O)NC(c2ccccc2)c2ccccc2)c([NH3+])c(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C23H24N2O4.ClH/c1-27-18-14-17(19(24)22(29-3)21(18)28-2)23(26)25-20(15-10-6-4-7-11-15)16-12-8-5-9-13-16;/h4-14,20H,24H2,1-3H3,(H,25,26);1H |
| InChIKey | XGTYZYXCHXFRFY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |