C25H28N2O5S — CID 30150400
N-benzhydryl-2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxybenzamide (PubChem CID 30150400) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-benzhydryl-2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxybenzamide.
| Compound Name | N-benzhydryl-2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 30150400 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-benzhydryl-2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxybenzamide |
| SMILES | CCS(=O)(=O)N(C)c1cc(OC)c(OC)cc1C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-5-33(29,30)27(2)21-17-23(32-4)22(31-3)16-20(21)25(28)26-24(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-17,24H,5H2,1-4H3,(H,26,28) |
| InChIKey | PPRLQIGKMUAZKF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |