C23H22BrNO4 — CID 985979
N-[(R)-(2-bromophenyl)-phenylmethyl]-3,4,5-trimethoxybenzamide (PubChem CID 985979) has the molecular formula C23H22BrNO4 and a molecular weight of 456.34 g/mol. Its IUPAC name is N-[(R)-(2-bromophenyl)-phenylmethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(R)-(2-bromophenyl)-phenylmethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 985979 |
| Molecular Formula | C23H22BrNO4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | N-[(R)-(2-bromophenyl)-phenylmethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@H](c2ccccc2)c2ccccc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C23H22BrNO4/c1-27-19-13-16(14-20(28-2)22(19)29-3)23(26)25-21(15-9-5-4-6-10-15)17-11-7-8-12-18(17)24/h4-14,21H,1-3H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | WBYQLDPALLXMGN-OAQYLSRUSA-N |
| XLogP | 4.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |