C29H27NO4 — CID 3969876
N-[1,2-dihydroacenaphthylen-5-yl(phenyl)methyl]-3,4,5-trimethoxybenzamide (PubChem CID 3969876) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-[1,2-dihydroacenaphthylen-5-yl(phenyl)methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1,2-dihydroacenaphthylen-5-yl(phenyl)methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3969876 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[1,2-dihydroacenaphthylen-5-yl(phenyl)methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(c2ccccc2)c2ccc3c4c(cccc24)CC3)cc(OC)c1OC |
| InChI | InChI=1S/C29H27NO4/c1-32-24-16-21(17-25(33-2)28(24)34-3)29(31)30-27(20-8-5-4-6-9-20)23-15-14-19-13-12-18-10-7-11-22(23)26(18)19/h4-11,14-17,27H,12-13H2,1-3H3,(H,30,31) |
| InChIKey | GWXUFZAFWIFQDZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |