About cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline
cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline (PubChem CID 155574889) has the molecular formula C16H17IN3O2P
and a molecular weight of 441.21 g/mol. Its IUPAC name is cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline.
Molecular Properties
| Compound Name | cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline |
| PubChem CID | 155574889 |
| Molecular Formula | C16H17IN3O2P |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline |
| SMILES | [H]/N=C/c1cc([N+](=O)[O-])ccc1NPI.c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C9H10.C7H7IN3O2P/c1-2-4-8(5-3-1)9-6-7-9;8-14-10-7-2-1-6(11(12)13)3-5(7)4-9/h1-5,9H,6-7H2;1-4,9-10,14H/b;9-4+ |
| InChIKey | QOFVLXJOKSOLNP-CDPAKSFWSA-N |
| XLogP | 5.51 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline?
The IUPAC name of cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline (CID 155574889) is cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline.
What is the SMILES notation for cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline?
The canonical SMILES for cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline is [H]/N=C/c1cc([N+](=O)[O-])ccc1NPI.c1ccc(C2CC2)cc1.
What is the InChIKey of cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline?
The InChIKey is QOFVLXJOKSOLNP-CDPAKSFWSA-N. The full InChI is InChI=1S/C9H10.C7H7IN3O2P/c1-2-4-8(5-3-1)9-6-7-9;8-14-10-7-2-1-6(11(12)13)3-5(7)4-9/h1-5,9H,6-7H2;1-4,9-10,14H/b;9-4+.
What are the key properties of cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline?
cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline has a molecular weight of 441.21 g/mol, XLogP of 5.51, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylbenzene;N-iodophosphanyl-2-methanimidoyl-4-nitroaniline is sourced from PubChem (CID 155574889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).