C10H8IN4O5P — CID 155482535
3-[2-(iodophosphanylamino)-5-nitrobenzenecarboximidoyl]-1,3-oxazolidine-2,4-dione (PubChem CID 155482535) has the molecular formula C10H8IN4O5P and a molecular weight of 422.08 g/mol. Its IUPAC name is 3-[2-(iodophosphanylamino)-5-nitrobenzenecarboximidoyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-[2-(iodophosphanylamino)-5-nitrobenzenecarboximidoyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 155482535 |
| Molecular Formula | C10H8IN4O5P |
| Molecular Weight | 422.08 g/mol |
| Exact Mass | 421.93 |
| IUPAC Name | 3-[2-(iodophosphanylamino)-5-nitrobenzenecarboximidoyl]-1,3-oxazolidine-2,4-dione |
| SMILES | [H]/N=C(/c1cc([N+](=O)[O-])ccc1NPI)N1C(=O)COC1=O |
| InChI | InChI=1S/C10H8IN4O5P/c11-21-13-7-2-1-5(15(18)19)3-6(7)9(12)14-8(16)4-20-10(14)17/h1-3,12-13,21H,4H2/b12-9- |
| InChIKey | BOTYMOKQXAHGKC-XFXZXTDPSA-N |
| XLogP | 2.25 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.08 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|