C10H12N2O2 — CID 155574912
ethyl 5-ethynyl-2,4-dimethylpyrazole-3-carboxylate (PubChem CID 155574912) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is ethyl 5-ethynyl-2,4-dimethylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-ethynyl-2,4-dimethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 155574912 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | ethyl 5-ethynyl-2,4-dimethylpyrazole-3-carboxylate |
| SMILES | C#Cc1nn(C)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C10H12N2O2/c1-5-8-7(3)9(12(4)11-8)10(13)14-6-2/h1H,6H2,2-4H3 |
| InChIKey | ZTBIGVXPKKLLRU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|