C7H9N3O2S2 — CID 70378432
ethyl 5-methylpyrazolo[3,4-d][1,3,2]dithiazole-6-carboxylate (PubChem CID 70378432) has the molecular formula C7H9N3O2S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is ethyl 5-methylpyrazolo[3,4-d][1,3,2]dithiazole-6-carboxylate.
| Compound Name | ethyl 5-methylpyrazolo[3,4-d][1,3,2]dithiazole-6-carboxylate |
|---|---|
| PubChem CID | 70378432 |
| Molecular Formula | C7H9N3O2S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | ethyl 5-methylpyrazolo[3,4-d][1,3,2]dithiazole-6-carboxylate |
| SMILES | CCOC(=O)c1c2c(nn1C)SNS2 |
| InChI | InChI=1S/C7H9N3O2S2/c1-3-12-7(11)4-5-6(8-10(4)2)14-9-13-5/h9H,3H2,1-2H3 |
| InChIKey | UOSANNTZKFJDAJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|