C24H22FN3O4Se — CID 155575089
10-fluoro-6,11-dihydrobenzo[c][2]benzoselenepine;11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 155575089) has the molecular formula C24H22FN3O4Se and a molecular weight of 514.42 g/mol. Its IUPAC name is 10-fluoro-6,11-dihydrobenzo[c][2]benzoselenepine;11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | 10-fluoro-6,11-dihydrobenzo[c][2]benzoselenepine;11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 155575089 |
| Molecular Formula | C24H22FN3O4Se |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 10-fluoro-6,11-dihydrobenzo[c][2]benzoselenepine;11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | Fc1cccc2c1Cc1ccccc1[Se]C2.O=C1c2c(O)c(=O)ccn2NC2COCCN12 |
| InChI | InChI=1S/C14H11FSe.C10H11N3O4/c15-13-6-3-5-11-9-16-14-7-2-1-4-10(14)8-12(11)13;14-6-1-2-13-8(9(6)15)10(16)12-3-4-17-5-7(12)11-13/h1-7H,8-9H2;1-2,7,11,15H,3-5H2 |
| InChIKey | HRLDXLCRMMLBOA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|