C16H17ClN4O — CID 155577047
1-[[5-[(4-chlorophenyl)methyl]morpholin-2-yl]methyl]pyrazole-4-carbonitrile (PubChem CID 155577047) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-[[5-[(4-chlorophenyl)methyl]morpholin-2-yl]methyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[[5-[(4-chlorophenyl)methyl]morpholin-2-yl]methyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 155577047 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[[5-[(4-chlorophenyl)methyl]morpholin-2-yl]methyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(CC2CNC(Cc3ccc(Cl)cc3)CO2)c1 |
| InChI | InChI=1S/C16H17ClN4O/c17-14-3-1-12(2-4-14)5-15-11-22-16(8-19-15)10-21-9-13(6-18)7-20-21/h1-4,7,9,15-16,19H,5,8,10-11H2 |
| InChIKey | WKEBJNDPSWCICF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |