C17H25NO7 — CID 155577249
9-O-tert-butyl 3-O-ethyl 4-hydroxy-2-oxo-1-oxa-9-azaspiro[5.5]undec-3-ene-3,9-dicarboxylate (PubChem CID 155577249) has the molecular formula C17H25NO7 and a molecular weight of 355.39 g/mol. Its IUPAC name is 9-O-tert-butyl 3-O-ethyl 4-hydroxy-2-oxo-1-oxa-9-azaspiro[5.5]undec-3-ene-3,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 3-O-ethyl 4-hydroxy-2-oxo-1-oxa-9-azaspiro[5.5]undec-3-ene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 155577249 |
| Molecular Formula | C17H25NO7 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 9-O-tert-butyl 3-O-ethyl 4-hydroxy-2-oxo-1-oxa-9-azaspiro[5.5]undec-3-ene-3,9-dicarboxylate |
| SMILES | CCOC(=O)C1=C(O)CC2(CCN(C(=O)OC(C)(C)C)CC2)OC1=O |
| InChI | InChI=1S/C17H25NO7/c1-5-23-13(20)12-11(19)10-17(24-14(12)21)6-8-18(9-7-17)15(22)25-16(2,3)4/h19H,5-10H2,1-4H3 |
| InChIKey | HQDAFHIHFHZSEB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|