C23H30N2O7 — CID 59311882
tert-butyl 2,4-dioxo-3-(3-oxo-3-phenylmethoxypropyl)-1-oxa-3,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 59311882) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is tert-butyl 2,4-dioxo-3-(3-oxo-3-phenylmethoxypropyl)-1-oxa-3,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 2,4-dioxo-3-(3-oxo-3-phenylmethoxypropyl)-1-oxa-3,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 59311882 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | tert-butyl 2,4-dioxo-3-(3-oxo-3-phenylmethoxypropyl)-1-oxa-3,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)N(CCC(=O)OCc1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C23H30N2O7/c1-22(2,3)31-20(28)24-13-10-23(11-14-24)15-18(26)25(21(29)32-23)12-9-19(27)30-16-17-7-5-4-6-8-17/h4-8H,9-16H2,1-3H3 |
| InChIKey | QQUAAGQXXAUCPV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|